C19H27N3O3S — CID 119072208
(4aS,7aR)-6,6-dioxo-N-[(1-phenylcyclopentyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide (PubChem CID 119072208) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is (4aS,7aR)-6,6-dioxo-N-[(1-phenylcyclopentyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide.
| Compound Name | (4aS,7aR)-6,6-dioxo-N-[(1-phenylcyclopentyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide |
|---|---|
| PubChem CID | 119072208 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (4aS,7aR)-6,6-dioxo-N-[(1-phenylcyclopentyl)methyl]-2,3,4a,5,7,7a-hexahydro-1H-thieno[3,4-b]pyrazine-4-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCC1)N1CCN[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C19H27N3O3S/c23-18(22-11-10-20-16-12-26(24,25)13-17(16)22)21-14-19(8-4-5-9-19)15-6-2-1-3-7-15/h1-3,6-7,16-17,20H,4-5,8-14H2,(H,21,23)/t16-,17+/m0/s1 |
| InChIKey | MKKNAMAXBYDNCO-DLBZAZTESA-N |
| XLogP | 1.28 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |