C18H26N2OS — CID 78886565
N-[(1-phenylcyclopentyl)methyl]-1,4-thiazepane-4-carboxamide (PubChem CID 78886565) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is N-[(1-phenylcyclopentyl)methyl]-1,4-thiazepane-4-carboxamide.
| Compound Name | N-[(1-phenylcyclopentyl)methyl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 78886565 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N-[(1-phenylcyclopentyl)methyl]-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCCC1)N1CCCSCC1 |
| InChI | InChI=1S/C18H26N2OS/c21-17(20-11-6-13-22-14-12-20)19-15-18(9-4-5-10-18)16-7-2-1-3-8-16/h1-3,7-8H,4-6,9-15H2,(H,19,21) |
| InChIKey | XYGJWUUCWLNPQV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |