C14H16ClFN2O3 — CID 107368637
2-[1-[(3-chloro-5-fluorophenyl)carbamoyl]piperidin-3-yl]acetic acid (PubChem CID 107368637) has the molecular formula C14H16ClFN2O3 and a molecular weight of 314.74 g/mol. Its IUPAC name is 2-[1-[(3-chloro-5-fluorophenyl)carbamoyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[1-[(3-chloro-5-fluorophenyl)carbamoyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107368637 |
| Molecular Formula | C14H16ClFN2O3 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[1-[(3-chloro-5-fluorophenyl)carbamoyl]piperidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1CCCN(C(=O)Nc2cc(F)cc(Cl)c2)C1 |
| InChI | InChI=1S/C14H16ClFN2O3/c15-10-5-11(16)7-12(6-10)17-14(21)18-3-1-2-9(8-18)4-13(19)20/h5-7,9H,1-4,8H2,(H,17,21)(H,19,20) |
| InChIKey | DHWCLKMIZKAREC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |