C21H21Cl2N3O — CID 153405510
2-[6-chloro-2-[2-(3-chloroanilino)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]acetaldehyde (PubChem CID 153405510) has the molecular formula C21H21Cl2N3O and a molecular weight of 402.33 g/mol. Its IUPAC name is 2-[6-chloro-2-[2-(3-chloroanilino)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]acetaldehyde.
| Compound Name | 2-[6-chloro-2-[2-(3-chloroanilino)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 153405510 |
| Molecular Formula | C21H21Cl2N3O |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 2-[6-chloro-2-[2-(3-chloroanilino)ethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]acetaldehyde |
| SMILES | O=CCC1c2[nH]c3ccc(Cl)cc3c2CCN1CCNc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H21Cl2N3O/c22-14-2-1-3-16(12-14)24-8-10-26-9-6-17-18-13-15(23)4-5-19(18)25-21(17)20(26)7-11-27/h1-5,11-13,20,24-25H,6-10H2 |
| InChIKey | ADPPHBOJABAACB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|