C18H14ClFN2O — CID 143312711
6-chloro-1-(3-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde (PubChem CID 143312711) has the molecular formula C18H14ClFN2O and a molecular weight of 328.77 g/mol. Its IUPAC name is 6-chloro-1-(3-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde.
| Compound Name | 6-chloro-1-(3-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde |
|---|---|
| PubChem CID | 143312711 |
| Molecular Formula | C18H14ClFN2O |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 6-chloro-1-(3-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde |
| SMILES | O=CN1CCc2c([nH]c3ccc(Cl)cc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C18H14ClFN2O/c19-12-4-5-16-15(9-12)14-6-7-22(10-23)18(17(14)21-16)11-2-1-3-13(20)8-11/h1-5,8-10,18,21H,6-7H2 |
| InChIKey | JKWXURLRUMDMLR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|