C18H16FN3O — CID 23113577
1-[10-(3-fluorophenyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone (PubChem CID 23113577) has the molecular formula C18H16FN3O and a molecular weight of 309.34 g/mol. Its IUPAC name is 1-[10-(3-fluorophenyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone.
| Compound Name | 1-[10-(3-fluorophenyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone |
|---|---|
| PubChem CID | 23113577 |
| Molecular Formula | C18H16FN3O |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-[10-(3-fluorophenyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone |
| SMILES | CC(=O)N1CCc2c([nH]c3ccncc23)C1c1cccc(F)c1 |
| InChI | InChI=1S/C18H16FN3O/c1-11(23)22-8-6-14-15-10-20-7-5-16(15)21-17(14)18(22)12-3-2-4-13(19)9-12/h2-5,7,9-10,18,21H,6,8H2,1H3 |
| InChIKey | NPRJSIRJYLZANL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |