C19H18FN3O2 — CID 67253494
1-[10-(3-fluorophenyl)-4-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone (PubChem CID 67253494) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 1-[10-(3-fluorophenyl)-4-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone.
| Compound Name | 1-[10-(3-fluorophenyl)-4-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone |
|---|---|
| PubChem CID | 67253494 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[10-(3-fluorophenyl)-4-methoxy-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraen-11-yl]ethanone |
| SMILES | COc1ccc2[nH]c3c(c2n1)CCN(C(C)=O)C3c1cccc(F)c1 |
| InChI | InChI=1S/C19H18FN3O2/c1-11(24)23-9-8-14-17-15(6-7-16(22-17)25-2)21-18(14)19(23)12-4-3-5-13(20)10-12/h3-7,10,19,21H,8-9H2,1-2H3 |
| InChIKey | OGIJCVNQTIQWBD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |