C22H24FN3O2 — CID 58403948
tert-butyl 10-(3-fluorophenyl)-4-methyl-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate (PubChem CID 58403948) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is tert-butyl 10-(3-fluorophenyl)-4-methyl-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate.
| Compound Name | tert-butyl 10-(3-fluorophenyl)-4-methyl-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 58403948 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl 10-(3-fluorophenyl)-4-methyl-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxylate |
| SMILES | Cc1ccc2[nH]c3c(c2n1)CCN(C(=O)OC(C)(C)C)C3c1cccc(F)c1 |
| InChI | InChI=1S/C22H24FN3O2/c1-13-8-9-17-18(24-13)16-10-11-26(21(27)28-22(2,3)4)20(19(16)25-17)14-6-5-7-15(23)12-14/h5-9,12,20,25H,10-11H2,1-4H3 |
| InChIKey | BYZWMRUDLCXNMC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |