C15H19F2NO2 — CID 87111482
tert-butyl (2R)-4-deuterio-4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 87111482) has the molecular formula C15H19F2NO2 and a molecular weight of 284.32 g/mol. Its IUPAC name is tert-butyl (2R)-4-deuterio-4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-deuterio-4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87111482 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | tert-butyl (2R)-4-deuterio-4-fluoro-2-(3-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | [2H]C1(F)C[C@H](c2cccc(F)c2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H19F2NO2/c1-15(2,3)20-14(19)18-9-12(17)8-13(18)10-5-4-6-11(16)7-10/h4-7,12-13H,8-9H2,1-3H3/t12?,13-/m1/s1/i12D |
| InChIKey | COTDZQGAESXLHT-ZZVYIRPRSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |