C18H26BrNO3 — CID 175470940
tert-butyl (2R)-2-(3-bromophenyl)-4-methoxy-5-methylpiperidine-1-carboxylate (PubChem CID 175470940) has the molecular formula C18H26BrNO3 and a molecular weight of 384.31 g/mol. Its IUPAC name is tert-butyl (2R)-2-(3-bromophenyl)-4-methoxy-5-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(3-bromophenyl)-4-methoxy-5-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 175470940 |
| Molecular Formula | C18H26BrNO3 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | tert-butyl (2R)-2-(3-bromophenyl)-4-methoxy-5-methylpiperidine-1-carboxylate |
| SMILES | COC1C[C@H](c2cccc(Br)c2)N(C(=O)OC(C)(C)C)CC1C |
| InChI | InChI=1S/C18H26BrNO3/c1-12-11-20(17(21)23-18(2,3)4)15(10-16(12)22-5)13-7-6-8-14(19)9-13/h6-9,12,15-16H,10-11H2,1-5H3/t12?,15-,16?/m1/s1 |
| InChIKey | PNGZJWLUBVGWPB-DSSZZKGTSA-N |
| XLogP | 4.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |