C16H23BrN2O4S — CID 66570173
tert-butyl 4-(3-bromophenyl)sulfonyl-2-methylpiperazine-1-carboxylate (PubChem CID 66570173) has the molecular formula C16H23BrN2O4S and a molecular weight of 419.34 g/mol. Its IUPAC name is tert-butyl 4-(3-bromophenyl)sulfonyl-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-bromophenyl)sulfonyl-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 66570173 |
| Molecular Formula | C16H23BrN2O4S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | tert-butyl 4-(3-bromophenyl)sulfonyl-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(S(=O)(=O)c2cccc(Br)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23BrN2O4S/c1-12-11-18(8-9-19(12)15(20)23-16(2,3)4)24(21,22)14-7-5-6-13(17)10-14/h5-7,10,12H,8-9,11H2,1-4H3 |
| InChIKey | GIPVKJGQWJCVQB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |