C16H22BrNO4S — CID 53425159
tert-butyl 3-(3-bromophenyl)sulfonylpiperidine-1-carboxylate (PubChem CID 53425159) has the molecular formula C16H22BrNO4S and a molecular weight of 404.33 g/mol. Its IUPAC name is tert-butyl 3-(3-bromophenyl)sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-bromophenyl)sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 53425159 |
| Molecular Formula | C16H22BrNO4S |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | tert-butyl 3-(3-bromophenyl)sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(S(=O)(=O)c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H22BrNO4S/c1-16(2,3)22-15(19)18-9-5-8-14(11-18)23(20,21)13-7-4-6-12(17)10-13/h4,6-7,10,14H,5,8-9,11H2,1-3H3 |
| InChIKey | DGIYMUYUUAILRG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |