C23H29BrFNO4S — CID 145183939
1-bromo-3-ethylbenzene;tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 145183939) has the molecular formula C23H29BrFNO4S and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-bromo-3-ethylbenzene;tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | 1-bromo-3-ethylbenzene;tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145183939 |
| Molecular Formula | C23H29BrFNO4S |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 1-bromo-3-ethylbenzene;tert-butyl 3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ccc(F)cc2)C1.CCc1cccc(Br)c1 |
| InChI | InChI=1S/C15H20FNO4S.C8H9Br/c1-15(2,3)21-14(18)17-9-8-13(10-17)22(19,20)12-6-4-11(16)5-7-12;1-2-7-4-3-5-8(9)6-7/h4-7,13H,8-10H2,1-3H3;3-6H,2H2,1H3 |
| InChIKey | LZGDSIDMNPVFIL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |