C15H21BrN2O4S — CID 155385811
tert-butyl N-[[1-(3-bromophenyl)sulfonylazetidin-3-yl]methyl]carbamate (PubChem CID 155385811) has the molecular formula C15H21BrN2O4S and a molecular weight of 405.31 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-bromophenyl)sulfonylazetidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(3-bromophenyl)sulfonylazetidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 155385811 |
| Molecular Formula | C15H21BrN2O4S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | tert-butyl N-[[1-(3-bromophenyl)sulfonylazetidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CN(S(=O)(=O)c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C15H21BrN2O4S/c1-15(2,3)22-14(19)17-8-11-9-18(10-11)23(20,21)13-6-4-5-12(16)7-13/h4-7,11H,8-10H2,1-3H3,(H,17,19) |
| InChIKey | SIWYQJLYLJPWHW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |