C17H24F3N3O4S — CID 170459178
tert-butyl (2R)-4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine-1-carboxylate (PubChem CID 170459178) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is tert-butyl (2R)-4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 170459178 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | tert-butyl (2R)-4-[4-amino-3-(trifluoromethyl)phenyl]sulfonyl-2-methylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(N)c(C(F)(F)F)c2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24F3N3O4S/c1-11-10-22(7-8-23(11)15(24)27-16(2,3)4)28(25,26)12-5-6-14(21)13(9-12)17(18,19)20/h5-6,9,11H,7-8,10,21H2,1-4H3/t11-/m1/s1 |
| InChIKey | HFPNLJVPPXIALN-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|