C15H21BFNO5 — CID 174202833
[2-fluoro-4-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phenyl]boronic acid (PubChem CID 174202833) has the molecular formula C15H21BFNO5 and a molecular weight of 325.15 g/mol. Its IUPAC name is [2-fluoro-4-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phenyl]boronic acid.
| Compound Name | [2-fluoro-4-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174202833 |
| Molecular Formula | C15H21BFNO5 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | [2-fluoro-4-[4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]phenyl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(O)CC1c1ccc(B(O)O)c(F)c1 |
| InChI | InChI=1S/C15H21BFNO5/c1-15(2,3)23-14(20)18-8-10(19)7-13(18)9-4-5-11(16(21)22)12(17)6-9/h4-6,10,13,19,21-22H,7-8H2,1-3H3 |
| InChIKey | PPEOFPQZFPLZSC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|