C17H24ClNO4 — CID 68803265
tert-butyl 2-(4-chloro-3-methoxyphenyl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 68803265) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is tert-butyl 2-(4-chloro-3-methoxyphenyl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-chloro-3-methoxyphenyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68803265 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl 2-(4-chloro-3-methoxyphenyl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | COc1cc(C2CC(O)CCN2C(=O)OC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C17H24ClNO4/c1-17(2,3)23-16(21)19-8-7-12(20)10-14(19)11-5-6-13(18)15(9-11)22-4/h5-6,9,12,14,20H,7-8,10H2,1-4H3 |
| InChIKey | HFMIBJJHSQLERM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |