C16H22FNO2 — CID 66684612
tert-butyl (3S)-2-(3-fluorophenyl)-3-methylpyrrolidine-1-carboxylate (PubChem CID 66684612) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is tert-butyl (3S)-2-(3-fluorophenyl)-3-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-2-(3-fluorophenyl)-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66684612 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | tert-butyl (3S)-2-(3-fluorophenyl)-3-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CCN(C(=O)OC(C)(C)C)C1c1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO2/c1-11-8-9-18(15(19)20-16(2,3)4)14(11)12-6-5-7-13(17)10-12/h5-7,10-11,14H,8-9H2,1-4H3/t11-,14?/m0/s1 |
| InChIKey | OMQQRFOFSFQVSP-ZSOXZCCMSA-N |
| XLogP | 4.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |