C25H23FN4O — CID 11690162
N-(3,5-dimethylphenyl)-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxamide (PubChem CID 11690162) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 11690162 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-(3,5-dimethylphenyl)-10-(3-fluorophenyl)-3,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5-tetraene-11-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)N2CCc3c([nH]c4cccnc34)C2c2cccc(F)c2)c1 |
| InChI | InChI=1S/C25H23FN4O/c1-15-11-16(2)13-19(12-15)28-25(31)30-10-8-20-22-21(7-4-9-27-22)29-23(20)24(30)17-5-3-6-18(26)14-17/h3-7,9,11-14,24,29H,8,10H2,1-2H3,(H,28,31) |
| InChIKey | UDNAPILCIRUEFP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |