C26H26N4O2 — CID 23113799
N-(3,5-dimethylphenyl)-6-(4-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide (PubChem CID 23113799) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-6-(4-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-6-(4-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 23113799 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-(3,5-dimethylphenyl)-6-(4-methoxyphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraene-5-carboxamide |
| SMILES | COc1ccc(C2c3[nH]c4ncccc4c3CCN2C(=O)Nc2cc(C)cc(C)c2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-16-13-17(2)15-19(14-16)28-26(31)30-12-10-21-22-5-4-11-27-25(22)29-23(21)24(30)18-6-8-20(32-3)9-7-18/h4-9,11,13-15,24H,10,12H2,1-3H3,(H,27,29)(H,28,31) |
| InChIKey | WZNUFSHTCUSJPW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |