C21H20ClFN2S — CID 143111450
6-chloro-1-[4-(2-fluoropropan-2-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothialdehyde (PubChem CID 143111450) has the molecular formula C21H20ClFN2S and a molecular weight of 386.92 g/mol. Its IUPAC name is 6-chloro-1-[4-(2-fluoropropan-2-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothialdehyde.
| Compound Name | 6-chloro-1-[4-(2-fluoropropan-2-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothialdehyde |
|---|---|
| PubChem CID | 143111450 |
| Molecular Formula | C21H20ClFN2S |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 6-chloro-1-[4-(2-fluoropropan-2-yl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothialdehyde |
| SMILES | CC(C)(F)c1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C=S)cc1 |
| InChI | InChI=1S/C21H20ClFN2S/c1-21(2,23)14-5-3-13(4-6-14)20-19-16(9-10-25(20)12-26)17-11-15(22)7-8-18(17)24-19/h3-8,11-12,20,24H,9-10H2,1-2H3 |
| InChIKey | HEBVPEJRFJHGGK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|