C29H30Cl2N4O3S — CID 145496308
2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethanamine;(4-chlorophenyl) formate;2H-thiazete (PubChem CID 145496308) has the molecular formula C29H30Cl2N4O3S and a molecular weight of 585.56 g/mol. Its IUPAC name is 2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethanamine;(4-chlorophenyl) formate;2H-thiazete.
| Compound Name | 2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethanamine;(4-chlorophenyl) formate;2H-thiazete |
|---|---|
| PubChem CID | 145496308 |
| Molecular Formula | C29H30Cl2N4O3S |
| Molecular Weight | 585.56 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethanamine;(4-chlorophenyl) formate;2H-thiazete |
| SMILES | CN1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCN)cc1.O=COc1ccc(Cl)cc1.c1cs[nH]1 |
| InChI | InChI=1S/C20H22ClN3O.C7H5ClO2.C2H3NS/c1-24-10-8-16-17-12-14(21)4-7-18(17)23-19(16)20(24)13-2-5-15(6-3-13)25-11-9-22;8-6-1-3-7(4-2-6)10-5-9;1-2-4-3-1/h2-7,12,20,23H,8-11,22H2,1H3;1-5H;1-3H |
| InChIKey | WOKSBRWVJWWOJL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|