C31H37ClN2O4 — CID 143111649
6-chloro-2-methyl-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane;(4-methoxy-5-methylcyclopenta-1,3-dien-1-yl) formate (PubChem CID 143111649) has the molecular formula C31H37ClN2O4 and a molecular weight of 537.10 g/mol. Its IUPAC name is 6-chloro-2-methyl-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane;(4-methoxy-5-methylcyclopenta-1,3-dien-1-yl) formate.
| Compound Name | 6-chloro-2-methyl-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane;(4-methoxy-5-methylcyclopenta-1,3-dien-1-yl) formate |
|---|---|
| PubChem CID | 143111649 |
| Molecular Formula | C31H37ClN2O4 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 6-chloro-2-methyl-1-(4-prop-2-enoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole;ethane;(4-methoxy-5-methylcyclopenta-1,3-dien-1-yl) formate |
| SMILES | C=CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C)cc1.CC.COC1=CC=C(OC=O)C1C |
| InChI | InChI=1S/C21H21ClN2O.C8H10O3.C2H6/c1-3-12-25-16-7-4-14(5-8-16)21-20-17(10-11-24(21)2)18-13-15(22)6-9-19(18)23-20;1-6-7(10-2)3-4-8(6)11-5-9;1-2/h3-9,13,21,23H,1,10-12H2,2H3;3-6H,1-2H3;1-2H3 |
| InChIKey | WEGICBMYSVFGMA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|