C33H37ClN4O5 — CID 91409584
2-[4-[6-chloro-2-[hydroxy-(4-methoxyphenoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(4-ethylpiperazin-1-yl)ethanone (PubChem CID 91409584) has the molecular formula C33H37ClN4O5 and a molecular weight of 605.14 g/mol. Its IUPAC name is 2-[4-[6-chloro-2-[hydroxy-(4-methoxyphenoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(4-ethylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-[6-chloro-2-[hydroxy-(4-methoxyphenoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(4-ethylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 91409584 |
| Molecular Formula | C33H37ClN4O5 |
| Molecular Weight | 605.14 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 2-[4-[6-chloro-2-[hydroxy-(4-methoxyphenoxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(4-ethylpiperazin-1-yl)ethanone |
| SMILES | CCN1CCN(C(=O)COc2ccc(C3c4[nH]c5ccc(Cl)cc5c4CCN3C(O)Oc3ccc(OC)cc3)cc2)CC1 |
| InChI | InChI=1S/C33H37ClN4O5/c1-3-36-16-18-37(19-17-36)30(39)21-42-25-7-4-22(5-8-25)32-31-27(28-20-23(34)6-13-29(28)35-31)14-15-38(32)33(40)43-26-11-9-24(41-2)10-12-26/h4-13,20,32-33,35,40H,3,14-19,21H2,1-2H3 |
| InChIKey | MOUIJWZETBTQTF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|