C30H29Cl2N5O4 — CID 91010574
[6-chloro-1-[4-methoxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol (PubChem CID 91010574) has the molecular formula C30H29Cl2N5O4 and a molecular weight of 594.50 g/mol. Its IUPAC name is [6-chloro-1-[4-methoxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol.
| Compound Name | [6-chloro-1-[4-methoxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol |
|---|---|
| PubChem CID | 91010574 |
| Molecular Formula | C30H29Cl2N5O4 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | [6-chloro-1-[4-methoxy-3-[3-(1,2,4-triazol-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(O)Oc2ccc(Cl)cc2)cc1OCCCn1cncn1 |
| InChI | InChI=1S/C30H29Cl2N5O4/c1-39-26-10-3-19(15-27(26)40-14-2-12-36-18-33-17-34-36)29-28-23(24-16-21(32)6-9-25(24)35-28)11-13-37(29)30(38)41-22-7-4-20(31)5-8-22/h3-10,15-18,29-30,35,38H,2,11-14H2,1H3 |
| InChIKey | PXPKFMZDIMJCOF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|