C31H30FN5O3 — CID 88995445
(4-fluorophenyl) 6-methyl-1-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88995445) has the molecular formula C31H30FN5O3 and a molecular weight of 539.61 g/mol. Its IUPAC name is (4-fluorophenyl) 6-methyl-1-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-fluorophenyl) 6-methyl-1-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88995445 |
| Molecular Formula | C31H30FN5O3 |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | (4-fluorophenyl) 6-methyl-1-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C(=O)Oc1ccc(F)cc1)C3c1ccc(OCCCCn2cncn2)cc1 |
| InChI | InChI=1S/C31H30FN5O3/c1-21-4-13-28-27(18-21)26-14-16-37(31(38)40-25-11-7-23(32)8-12-25)30(29(26)35-28)22-5-9-24(10-6-22)39-17-3-2-15-36-20-33-19-34-36/h4-13,18-20,30,35H,2-3,14-17H2,1H3 |
| InChIKey | YEKZKGMKHHARRL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|