C30H29Cl2N5O4 — CID 91216999
(4-chlorophenyl) 1-[3-[3-[(aminomethylideneamino)methylideneamino]propoxy]-4-methoxyphenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91216999) has the molecular formula C30H29Cl2N5O4 and a molecular weight of 594.50 g/mol. Its IUPAC name is (4-chlorophenyl) 1-[3-[3-[(aminomethylideneamino)methylideneamino]propoxy]-4-methoxyphenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 1-[3-[3-[(aminomethylideneamino)methylideneamino]propoxy]-4-methoxyphenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91216999 |
| Molecular Formula | C30H29Cl2N5O4 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.16 |
| IUPAC Name | (4-chlorophenyl) 1-[3-[3-[(aminomethylideneamino)methylideneamino]propoxy]-4-methoxyphenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(Cl)cc2)cc1OCCC/N=C/N=C/N |
| InChI | InChI=1S/C30H29Cl2N5O4/c1-39-26-10-3-19(15-27(26)40-14-2-12-34-18-35-17-33)29-28-23(24-16-21(32)6-9-25(24)36-28)11-13-37(29)30(38)41-22-7-4-20(31)5-8-22/h3-10,15-18,29,36H,2,11-14H2,1H3,(H2,33,34,35) |
| InChIKey | HNSOEYJIJPUIAV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|