C30H29Cl2N5O3 — CID 123160329
[1-[4-[2-(3-amino-5-methylpyrazol-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol (PubChem CID 123160329) has the molecular formula C30H29Cl2N5O3 and a molecular weight of 578.50 g/mol. Its IUPAC name is [1-[4-[2-(3-amino-5-methylpyrazol-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol.
| Compound Name | [1-[4-[2-(3-amino-5-methylpyrazol-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol |
|---|---|
| PubChem CID | 123160329 |
| Molecular Formula | C30H29Cl2N5O3 |
| Molecular Weight | 578.50 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | [1-[4-[2-(3-amino-5-methylpyrazol-1-yl)ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-chlorophenoxy)methanol |
| SMILES | Cc1cc(N)nn1CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(O)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H29Cl2N5O3/c1-18-16-27(33)35-37(18)14-15-39-22-7-2-19(3-8-22)29-28-24(25-17-21(32)6-11-26(25)34-28)12-13-36(29)30(38)40-23-9-4-20(31)5-10-23/h2-11,16-17,29-30,34,38H,12-15H2,1H3,(H2,33,35) |
| InChIKey | UFBJSZCIDNWTPX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|