C26H31ClN2O5 — CID 155173053
(2S)-3-[4-[(1S)-6-chloro-2-[cyclobutylmethoxy(hydroxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]propane-1,2-diol (PubChem CID 155173053) has the molecular formula C26H31ClN2O5 and a molecular weight of 487.00 g/mol. Its IUPAC name is (2S)-3-[4-[(1S)-6-chloro-2-[cyclobutylmethoxy(hydroxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]propane-1,2-diol.
| Compound Name | (2S)-3-[4-[(1S)-6-chloro-2-[cyclobutylmethoxy(hydroxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 155173053 |
| Molecular Formula | C26H31ClN2O5 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (2S)-3-[4-[(1S)-6-chloro-2-[cyclobutylmethoxy(hydroxy)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]propane-1,2-diol |
| SMILES | OC[C@H](O)COc1ccc([C@H]2c3[nH]c4ccc(Cl)cc4c3CCN2C(O)OCC2CCC2)cc1 |
| InChI | InChI=1S/C26H31ClN2O5/c27-18-6-9-23-22(12-18)21-10-11-29(26(32)34-14-16-2-1-3-16)25(24(21)28-23)17-4-7-20(8-5-17)33-15-19(31)13-30/h4-9,12,16,19,25-26,28,30-32H,1-3,10-11,13-15H2/t19-,25-,26?/m0/s1 |
| InChIKey | OODOATARFFRGCP-KPPKKOGNSA-N |
| XLogP | 3.59 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|