C33H35Cl2N3O5 — CID 67986219
(4-chlorophenyl) (1S)-6-chloro-1-[4-[1-[(3S)-3,4-dihydroxybutyl]piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67986219) has the molecular formula C33H35Cl2N3O5 and a molecular weight of 624.57 g/mol. Its IUPAC name is (4-chlorophenyl) (1S)-6-chloro-1-[4-[1-[(3S)-3,4-dihydroxybutyl]piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) (1S)-6-chloro-1-[4-[1-[(3S)-3,4-dihydroxybutyl]piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67986219 |
| Molecular Formula | C33H35Cl2N3O5 |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | (4-chlorophenyl) (1S)-6-chloro-1-[4-[1-[(3S)-3,4-dihydroxybutyl]piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)[C@@H]1c1ccc(OC2CCN(CC[C@H](O)CO)CC2)cc1 |
| InChI | InChI=1S/C33H35Cl2N3O5/c34-22-3-8-26(9-4-22)43-33(41)38-18-14-28-29-19-23(35)5-10-30(29)36-31(28)32(38)21-1-6-25(7-2-21)42-27-12-16-37(17-13-27)15-11-24(40)20-39/h1-10,19,24,27,32,36,39-40H,11-18,20H2/t24-,32-/m0/s1 |
| InChIKey | YCXVPIRXUUNMAF-BNHRFMORSA-N |
| XLogP | 6.21 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|