C36H38ClIN4O6 — CID 88995016
(4-iodophenyl) (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethoxycarbonyl)piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88995016) has the molecular formula C36H38ClIN4O6 and a molecular weight of 785.08 g/mol. Its IUPAC name is (4-iodophenyl) (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethoxycarbonyl)piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-iodophenyl) (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethoxycarbonyl)piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88995016 |
| Molecular Formula | C36H38ClIN4O6 |
| Molecular Weight | 785.08 g/mol |
| Exact Mass | 784.15 |
| IUPAC Name | (4-iodophenyl) (1S)-6-chloro-1-[4-[1-(2-morpholin-4-ylethoxycarbonyl)piperidin-4-yl]oxyphenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OCCN1CCOCC1)N1CCC(Oc2ccc([C@H]3c4[nH]c5ccc(Cl)cc5c4CCN3C(=O)Oc3ccc(I)cc3)cc2)CC1 |
| InChI | InChI=1S/C36H38ClIN4O6/c37-25-3-10-32-31(23-25)30-13-16-42(36(44)48-28-8-4-26(38)5-9-28)34(33(30)39-32)24-1-6-27(7-2-24)47-29-11-14-41(15-12-29)35(43)46-22-19-40-17-20-45-21-18-40/h1-10,23,29,34,39H,11-22H2/t34-/m0/s1 |
| InChIKey | VIZRZKJRGAUPSM-UMSFTDKQSA-N |
| XLogP | 6.88 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.08 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|