C29H30ClN3O6S — CID 123252520
[6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenoxy)methanol (PubChem CID 123252520) has the molecular formula C29H30ClN3O6S and a molecular weight of 584.09 g/mol. Its IUPAC name is [6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenoxy)methanol.
| Compound Name | [6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenoxy)methanol |
|---|---|
| PubChem CID | 123252520 |
| Molecular Formula | C29H30ClN3O6S |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | [6-chloro-1-(4-morpholin-4-ylsulfonylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(4-methoxyphenoxy)methanol |
| SMILES | COc1ccc(OC(O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H30ClN3O6S/c1-37-21-5-7-22(8-6-21)39-29(34)33-13-12-24-25-18-20(30)4-11-26(25)31-27(24)28(33)19-2-9-23(10-3-19)40(35,36)32-14-16-38-17-15-32/h2-11,18,28-29,31,34H,12-17H2,1H3 |
| InChIKey | OVSNCFPIUSNUHH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|