C30H37ClN4O4 — CID 143535794
(1Z,3E)-N-[2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethyl]-1-(methylideneamino)penta-1,3-dien-3-amine;2-methoxyethyl formate (PubChem CID 143535794) has the molecular formula C30H37ClN4O4 and a molecular weight of 553.10 g/mol. Its IUPAC name is (1Z,3E)-N-[2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethyl]-1-(methylideneamino)penta-1,3-dien-3-amine;2-methoxyethyl formate.
| Compound Name | (1Z,3E)-N-[2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethyl]-1-(methylideneamino)penta-1,3-dien-3-amine;2-methoxyethyl formate |
|---|---|
| PubChem CID | 143535794 |
| Molecular Formula | C30H37ClN4O4 |
| Molecular Weight | 553.10 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | (1Z,3E)-N-[2-[4-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenoxy]ethyl]-1-(methylideneamino)penta-1,3-dien-3-amine;2-methoxyethyl formate |
| SMILES | C=N/C=C\C(=C/C)NCCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C)cc1.COCCOC=O |
| InChI | InChI=1S/C26H29ClN4O.C4H8O3/c1-4-20(11-13-28-2)29-14-16-32-21-8-5-18(6-9-21)26-25-22(12-15-31(26)3)23-17-19(27)7-10-24(23)30-25;1-6-2-3-7-4-5/h4-11,13,17,26,29-30H,2,12,14-16H2,1,3H3;4H,2-3H2,1H3/b13-11-,20-4+; |
| InChIKey | SNYYRONAAQYWHZ-RRMJDNQMSA-N |
| XLogP | 5.29 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.10 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|