C27H29ClN6O4 — CID 155000658
2-methoxyethyl 1-[4-[2-[[(E)-3-amino-2-cyano-3-iminoprop-1-enyl]amino]ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 155000658) has the molecular formula C27H29ClN6O4 and a molecular weight of 537.02 g/mol. Its IUPAC name is 2-methoxyethyl 1-[4-[2-[[(E)-3-amino-2-cyano-3-iminoprop-1-enyl]amino]ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | 2-methoxyethyl 1-[4-[2-[[(E)-3-amino-2-cyano-3-iminoprop-1-enyl]amino]ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 155000658 |
| Molecular Formula | C27H29ClN6O4 |
| Molecular Weight | 537.02 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-methoxyethyl 1-[4-[2-[[(E)-3-amino-2-cyano-3-iminoprop-1-enyl]amino]ethoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | [H]/N=C(N)/C(C#N)=C\NCCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)OCCOC)cc1 |
| InChI | InChI=1S/C27H29ClN6O4/c1-36-12-13-38-27(35)34-10-8-21-22-14-19(28)4-7-23(22)33-24(21)25(34)17-2-5-20(6-3-17)37-11-9-32-16-18(15-29)26(30)31/h2-7,14,16,25,32-33H,8-13H2,1H3,(H3,30,31)/b18-16- |
| InChIKey | KFAKYIHMCJGXOL-VLGSPTGOSA-N |
| XLogP | 3.86 |
| TPSA | 149.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.02 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|