C19H20ClN3O2 — CID 143312945
6-chloro-1-[(1E,3E,5Z)-1-(hydroxyamino)hepta-1,3,5-trien-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde (PubChem CID 143312945) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 6-chloro-1-[(1E,3E,5Z)-1-(hydroxyamino)hepta-1,3,5-trien-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde.
| Compound Name | 6-chloro-1-[(1E,3E,5Z)-1-(hydroxyamino)hepta-1,3,5-trien-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde |
|---|---|
| PubChem CID | 143312945 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 6-chloro-1-[(1E,3E,5Z)-1-(hydroxyamino)hepta-1,3,5-trien-4-yl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbaldehyde |
| SMILES | C/C=C\C(=C/C=C/NO)C1c2[nH]c3ccc(Cl)cc3c2CCN1C=O |
| InChI | InChI=1S/C19H20ClN3O2/c1-2-4-13(5-3-9-21-25)19-18-15(8-10-23(19)12-24)16-11-14(20)6-7-17(16)22-18/h2-7,9,11-12,19,21-22,25H,8,10H2,1H3/b4-2-,9-3+,13-5+ |
| InChIKey | IALZORNSBMVSLO-QFGVCDLTSA-N |
| XLogP | 3.87 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|