C18H21ClN2O2 — CID 18317970
1-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 18317970) has the molecular formula C18H21ClN2O2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 1-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 18317970 |
| Molecular Formula | C18H21ClN2O2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(6-chloro-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)cyclopentane-1-carboxylic acid |
| SMILES | CN1CCc2c([nH]c3ccc(Cl)cc23)C1C1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C18H21ClN2O2/c1-21-9-6-12-13-10-11(19)4-5-14(13)20-15(12)16(21)18(17(22)23)7-2-3-8-18/h4-5,10,16,20H,2-3,6-9H2,1H3,(H,22,23) |
| InChIKey | QNROLSJEFZGUBZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|