C13H11ClNO2- — CID 7074070
(1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate (PubChem CID 7074070) has the molecular formula C13H11ClNO2- and a molecular weight of 248.69 g/mol. Its IUPAC name is (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate.
| Compound Name | (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate |
|---|---|
| PubChem CID | 7074070 |
| Molecular Formula | C13H11ClNO2- |
| Molecular Weight | 248.69 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | (1R)-6-chloro-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate |
| SMILES | O=C([O-])[C@@H]1CCCc2c1[nH]c1ccc(Cl)cc21 |
| InChI | InChI=1S/C13H12ClNO2/c14-7-4-5-11-10(6-7)8-2-1-3-9(13(16)17)12(8)15-11/h4-6,9,15H,1-3H2,(H,16,17)/p-1/t9-/m1/s1 |
| InChIKey | KBAOXJSNMBNBHM-SECBINFHSA-M |
| XLogP | 1.99 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |