C16H18ClN3O — CID 18317945
1-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxamide (PubChem CID 18317945) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 1-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 18317945 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-(6-chloro-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxamide |
| SMILES | NC(=O)C1(C2NCCc3c2[nH]c2ccc(Cl)cc32)CCC1 |
| InChI | InChI=1S/C16H18ClN3O/c17-9-2-3-12-11(8-9)10-4-7-19-14(13(10)20-12)16(15(18)21)5-1-6-16/h2-3,8,14,19-20H,1,4-7H2,(H2,18,21) |
| InChIKey | RMGUCUKYYSXPOH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|