C24H26N2O2 — CID 18317908
ethyl 1-(6-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylate (PubChem CID 18317908) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is ethyl 1-(6-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-(6-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 18317908 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | ethyl 1-(6-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(C2NCCc3c2[nH]c2ccc(-c4ccccc4)cc32)CCC1 |
| InChI | InChI=1S/C24H26N2O2/c1-2-28-23(27)24(12-6-13-24)22-21-18(11-14-25-22)19-15-17(9-10-20(19)26-21)16-7-4-3-5-8-16/h3-5,7-10,15,22,25-26H,2,6,11-14H2,1H3 |
| InChIKey | MHZZCVXWOSHOSI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|