C19H24N2O4 — CID 101391443
diethyl (1R)-1-ethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate (PubChem CID 101391443) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is diethyl (1R)-1-ethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate.
| Compound Name | diethyl (1R)-1-ethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101391443 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | diethyl (1R)-1-ethyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2c([nH]c3ccccc23)[C@@H](CC)N1 |
| InChI | InChI=1S/C19H24N2O4/c1-4-14-16-13(12-9-7-8-10-15(12)20-16)11-19(21-14,17(22)24-5-2)18(23)25-6-3/h7-10,14,20-21H,4-6,11H2,1-3H3/t14-/m1/s1 |
| InChIKey | PCILVVDBRGOOFJ-CQSZACIVSA-N |
| XLogP | 2.63 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|