C22H30N2O5 — CID 101391450
diethyl (1R)-1-butyl-6-methoxy-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate (PubChem CID 101391450) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is diethyl (1R)-1-butyl-6-methoxy-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate.
| Compound Name | diethyl (1R)-1-butyl-6-methoxy-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101391450 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | diethyl (1R)-1-butyl-6-methoxy-1,2,4,9-tetrahydropyrido[3,4-b]indole-3,3-dicarboxylate |
| SMILES | CCCC[C@H]1NC(C(=O)OCC)(C(=O)OCC)Cc2c1[nH]c1ccc(OC)cc21 |
| InChI | InChI=1S/C22H30N2O5/c1-5-8-9-18-19-16(15-12-14(27-4)10-11-17(15)23-19)13-22(24-18,20(25)28-6-2)21(26)29-7-3/h10-12,18,23-24H,5-9,13H2,1-4H3/t18-/m1/s1 |
| InChIKey | WHDNJHUZOXSNBD-GOSISDBHSA-N |
| XLogP | 3.42 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|