C20H20N2O3 — CID 141182629
6-methoxy-3-methyl-1-phenyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 141182629) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 6-methoxy-3-methyl-1-phenyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 6-methoxy-3-methyl-1-phenyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 141182629 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 6-methoxy-3-methyl-1-phenyl-1,2,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC(C)(C(=O)O)NC3c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c1-20(19(23)24)11-15-14-10-13(25-2)8-9-16(14)21-18(15)17(22-20)12-6-4-3-5-7-12/h3-10,17,21-22H,11H2,1-2H3,(H,23,24) |
| InChIKey | MFAGBDMTUMVSPP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|