C22H23NO3 — CID 70535381
ethyl 6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazole-3-carboxylate (PubChem CID 70535381) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazole-3-carboxylate.
| Compound Name | ethyl 6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazole-3-carboxylate |
|---|---|
| PubChem CID | 70535381 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | ethyl 6-methoxy-3-phenyl-1,2,4,9-tetrahydrocarbazole-3-carboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)CCc2[nH]c3ccc(OC)cc3c2C1 |
| InChI | InChI=1S/C22H23NO3/c1-3-26-21(24)22(15-7-5-4-6-8-15)12-11-20-18(14-22)17-13-16(25-2)9-10-19(17)23-20/h4-10,13,23H,3,11-12,14H2,1-2H3 |
| InChIKey | QDAJHDBNIKKZHI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|