C17H19NO2 — CID 905333
ethyl (E)-3-[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]prop-2-enoate (PubChem CID 905333) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethyl (E)-3-[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]prop-2-enoate |
|---|---|
| PubChem CID | 905333 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethyl (E)-3-[(1S)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C17H19NO2/c1-2-20-16(19)11-10-12-6-5-8-14-13-7-3-4-9-15(13)18-17(12)14/h3-4,7,9-12,18H,2,5-6,8H2,1H3/b11-10+/t12-/m0/s1 |
| InChIKey | SMHOJQOZSSTOIW-IIANPFDCSA-N |
| XLogP | 3.71 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|