C19H24N2O3 — CID 177397393
ethyl (E)-6-hydroxy-3-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]hex-2-enoate (PubChem CID 177397393) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethyl (E)-6-hydroxy-3-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]hex-2-enoate.
| Compound Name | ethyl (E)-6-hydroxy-3-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]hex-2-enoate |
|---|---|
| PubChem CID | 177397393 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | ethyl (E)-6-hydroxy-3-[(1R)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]hex-2-enoate |
| SMILES | CCOC(=O)/C=C(\CCCO)[C@H]1NCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C19H24N2O3/c1-2-24-17(23)12-13(6-5-11-22)18-19-15(9-10-20-18)14-7-3-4-8-16(14)21-19/h3-4,7-8,12,18,20-22H,2,5-6,9-11H2,1H3/b13-12+/t18-/m1/s1 |
| InChIKey | AJTNDBYKEGVNQF-QFQMRYFISA-N |
| XLogP | 2.62 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|