C16H16N2O2 — CID 26342306
ethyl (8R)-8-cyano-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 26342306) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is ethyl (8R)-8-cyano-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | ethyl (8R)-8-cyano-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 26342306 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | ethyl (8R)-8-cyano-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c3c(c2c1)CCC[C@H]3C#N |
| InChI | InChI=1S/C16H16N2O2/c1-2-20-16(19)10-6-7-14-13(8-10)12-5-3-4-11(9-17)15(12)18-14/h6-8,11,18H,2-5H2,1H3/t11-/m0/s1 |
| InChIKey | SFLUDBHDSVXCFC-NSHDSACASA-N |
| XLogP | 3.29 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |