C15H17NO3 — CID 23765459
ethyl 5-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 23765459) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is ethyl 5-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 23765459 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | ethyl 5-hydroxy-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c3c(c2c1)C(O)CCC3 |
| InChI | InChI=1S/C15H17NO3/c1-2-19-15(18)9-6-7-11-10(8-9)14-12(16-11)4-3-5-13(14)17/h6-8,13,16-17H,2-5H2,1H3 |
| InChIKey | GFFMNXPWMMWIFM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|