C40H40N4O4 — CID 159619714
methyl 8-anilino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 159619714) has the molecular formula C40H40N4O4 and a molecular weight of 640.78 g/mol. Its IUPAC name is methyl 8-anilino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | methyl 8-anilino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 159619714 |
| Molecular Formula | C40H40N4O4 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.30 |
| IUPAC Name | methyl 8-anilino-6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CCCC3Nc1ccccc1.COC(=O)c1ccc2[nH]c3c(c2c1)CCCC3Nc1ccccc1 |
| InChI | InChI=1S/2C20H20N2O2/c2*1-24-20(23)13-10-11-17-16(12-13)15-8-5-9-18(19(15)22-17)21-14-6-3-2-4-7-14/h2*2-4,6-7,10-12,18,21-22H,5,8-9H2,1H3 |
| InChIKey | MNSURTNPIXDPDB-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 108.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|