C15H18ClN2O2- — CID 21179161
ethyl 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate chloride (PubChem CID 21179161) has the molecular formula C15H18ClN2O2- and a molecular weight of 293.77 g/mol. Its IUPAC name is ethyl 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate chloride.
| Compound Name | ethyl 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate chloride |
|---|---|
| PubChem CID | 21179161 |
| Molecular Formula | C15H18ClN2O2- |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | ethyl 1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate chloride |
| SMILES | CCOC(=O)C1Cc2c([nH]c3ccccc23)C(C)N1.[Cl-] |
| InChI | InChI=1S/C15H18N2O2.ClH/c1-3-19-15(18)13-8-11-10-6-4-5-7-12(10)17-14(11)9(2)16-13;/h4-7,9,13,16-17H,3,8H2,1-2H3;1H/p-1 |
| InChIKey | AVKPTYZTDJBNAG-UHFFFAOYSA-M |
| XLogP | -0.69 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|