C13H16N4O — CID 156772304
(1R,3R)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide (PubChem CID 156772304) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is (1R,3R)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide.
| Compound Name | (1R,3R)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide |
|---|---|
| PubChem CID | 156772304 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (1R,3R)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbohydrazide |
| SMILES | C[C@H]1N[C@@H](C(=O)NN)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C13H16N4O/c1-7-12-9(6-11(15-7)13(18)17-14)8-4-2-3-5-10(8)16-12/h2-5,7,11,15-16H,6,14H2,1H3,(H,17,18)/t7-,11-/m1/s1 |
| InChIKey | JBWBBKSDBPQCII-RDDDGLTNSA-N |
| XLogP | 0.73 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|